On Target TNFA_HUMAN 0.34597155/CHEMBL2337623
For the given ligand Aspirin, we have found in our database that, being scored 0.34597155, the most similar ligand is CHEMBL2337623. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL2337623 (Similar Ligand) |
|---|---|
| CO/C3=C/C2CC(c1ccc(OC)cc1)CC(=O)C2/C(O)=C3/OC | CCCCOC(=O)/C=C/c1cc(OC)c(O)c2c1C[C@@H]1[C@@H]3C=C(OC)C(=O)C[C@]23CCN1C |
|
|
|
|
|
|
| 00010000 81040008 2200010a 10010200 40483000 00000801 02040140 18001400 00002840 00580840 48100000 40409200 9402800a 00a00000 03000401 0008000c 00000000 02000000 02402098 0a022001 00000100 08000200 05008000 08400012 00001800 80002400 00524000 80000000 00014202 80020002 24020840 00000410 | 100d0000 4b000208 2010010a 00110700 20081021 c0002002 870c0180 2000060b 01800880 001888ca 48300000 5191d040 8402c01a 20a00000 03000423 020cb00a 20820600 82000060 2049a018 00020201 00100120 18200a90 0100c001 81540010 00201c00 80002001 04526008 d0000580 04404202 0026c50a 2c020000 00012710 |