On Target DRD2_HUMAN 0.3478261/CHEMBL292186
For the given ligand Aspirin, we have found in our database that, being scored 0.3478261, the most similar ligand is CHEMBL292186. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL292186 (Similar Ligand) |
|---|---|
| CO/C3=C/C2CC(c1ccc(OC)cc1)CC(=O)C2/C(O)=C3/OC | COc1cc2ccccc2cc1C(=O)CCC1CCN(Cc2ccccc2)CC1 |
|
|
|
|
|
|
| 00010000 81040008 2200010a 10010200 40483000 00000801 02040140 18001400 00002840 00580840 48100000 40409200 9402800a 00a00000 03000401 0008000c 00000000 02000000 02402098 0a022001 00000100 08000200 05008000 08400012 00001800 80002400 00524000 80000000 00014202 80020002 24020840 00000410 | 00010000 01000808 2010010a 00010600 00001000 00020000 02000000 22001200 00000800 000808c0 08300000 50019040 0400880a 00200000 01000401 00002008 00000000 02000000 00002000 00020201 00000100 18028218 00000000 00500414 00000000 c0000000 00000800 90000000 00000302 00064002 a0060000 00000600 |