On Target HPGDS_HUMAN 0.26865673/CHEMBL1743209
For the given ligand Aspirin, we have found in our database that, being scored 0.26865673, the most similar ligand is CHEMBL1743209. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL1743209 (Similar Ligand) |
|---|---|
| CO/C3=C/C2CC(c1ccc(OC)cc1)CC(=O)C2/C(O)=C3/OC | CCCCC[C@H](O)/C=C/[C@H]1C2CC(OO2)[C@@H]1C/C=C\CCCC(=O)O |
|
|
|
|
|
|
| 00010000 81040008 2200010a 10010200 40483000 00000801 02040140 18001400 00002840 00580840 48100000 40409200 9402800a 00a00000 03000401 0008000c 00000000 02000000 02402098 0a022001 00000100 08000200 05008000 08400012 00001800 80002400 00524000 80000000 00014202 80020002 24020840 00000410 | 00010000 81040000 00000800 00000000 00280000 00080001 00000000 28000402 00000000 00108008 00000200 40001000 04128000 00800080 00000404 00080028 00100800 00000010 21402010 00002001 01004000 20020a00 01008000 00000010 00201000 00000400 00424204 80001000 00000000 01000000 24020001 00000000 |