On Target TRPM4_HUMAN 0.1724138/CHEMBL1408302
For the given ligand Aspirin, we have found in our database that, being scored 0.1724138, the most similar ligand is CHEMBL1408302. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL1408302 (Similar Ligand) |
|---|---|
| CO/C3=C/C2CC(c1ccc(OC)cc1)CC(=O)C2/C(O)=C3/OC | O=C(COc1cccc2ccccc12)Nc1cc(Cl)ccc1C(=O)O |
|
|
|
|
|
|
| 00010000 81040008 2200010a 10010200 40483000 00000801 02040140 18001400 00002840 00580840 48100000 40409200 9402800a 00a00000 03000401 0008000c 00000000 02000000 02402098 0a022001 00000100 08000200 05008000 08400012 00001800 80002400 00524000 80000000 00014202 80020002 24020840 00000410 | 1401e002 00000808 20001108 01010602 00001080 00014040 0a000000 00080100 00800100 00080840 002c0084 4000d800 06808086 00100001 01021041 00080008 00040000 82000000 08000000 00024000 40100000 08060f28 32002000 00400004 00002000 80000000 08040018 00001080 00008200 00060001 c0000000 00020200 |