On Target AOFB_HUMAN 0.36090225/CHEMBL3288305
For the given ligand Aspirin, we have found in our database that, being scored 0.36090225, the most similar ligand is CHEMBL3288305. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL3288305 (Similar Ligand) |
|---|---|
| CO/C3=C/C2CC(c1ccc(OC)cc1)CC(=O)C2/C(O)=C3/OC | O=C1CCCc2cc(OCCCc3ccccc3)ccc21 |
|
|
|
|
|
|
| 00010000 81040008 2200010a 10010200 40483000 00000801 02040140 18001400 00002840 00580840 48100000 40409200 9402800a 00a00000 03000401 0008000c 00000000 02000000 02402098 0a022001 00000100 08000200 05008000 08400012 00001800 80002400 00524000 80000000 00014202 80020002 24020840 00000410 | 04010000 43000808 2000010b 00010300 00001000 42008000 02040000 00000001 00000800 00080840 08100000 40009000 04808002 20200080 11000001 00082008 00000200 02000000 00482000 00020201 00400100 08020240 01004040 00400014 00000000 80000001 00120000 00000000 00000202 00020002 80000000 00400400 |