On Target CNR1_HUMAN 0.44078946/CHEMBL456341
For the given ligand Aspirin, we have found in our database that, being scored 0.44078946, the most similar ligand is CHEMBL456341. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL456341 (Similar Ligand) |
|---|---|
| CO/C3=C/C2CC(c1ccc(OC)cc1)CC(=O)C2/C(O)=C3/OC | CCCCCCC(C)(C)c1cc(O)c2c(c1)OC(C)(C)[C@@H]1CC=C(C(=O)O)C[C@@H]21 |
|
|
|
|
|
|
| 00010000 81040008 2200010a 10010200 40483000 00000801 02040140 18001400 00002840 00580840 48100000 40409200 9402800a 00a00000 03000401 0008000c 00000000 02000000 02402098 0a022001 00000100 08000200 05008000 08400012 00001800 80002400 00524000 80000000 00014202 80020002 24020840 00000410 | 04010001 c3000018 2000010a 80110300 00081000 c2000000 42000080 08000602 01000900 0018084a 08100000 40009840 0482800a 20a00080 11000401 00082008 00800000 22008020 00492010 00022a01 00000100 08000a80 01008040 00400410 00201000 c0002400 04404000 80000000 00010302 00034002 24020000 00410400 |