On Target NMDE2_HUMAN 0.3309859/CHEMBL4294561
For the given ligand Aspirin, we have found in our database that, being scored 0.3309859, the most similar ligand is CHEMBL4294561. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL4294561 (Similar Ligand) |
|---|---|
| CO/C3=C/C2CC(c1ccc(OC)cc1)CC(=O)C2/C(O)=C3/OC | COc1ccc2c(c1)CC[C@@H](NCCCc1ccccc1)C[C@H]2O |
|
|
|
|
|
|
| 00010000 81040008 2200010a 10010200 40483000 00000801 02040140 18001400 00002840 00580840 48100000 40409200 9402800a 00a00000 03000401 0008000c 00000000 02000000 02402098 0a022001 00000100 08000200 05008000 08400012 00001800 80002400 00524000 80000000 00014202 80020002 24020840 00000410 | 00000000 43000208 2010010a 00010600 00081000 40004002 02040000 20000001 00000900 000808c0 08300000 40008800 00000002 20a00000 01000021 020c0008 01000000 02000000 00c82000 00020201 00000500 18000020 01004080 00400010 00000001 80000201 00520000 10000000 00000202 0006000a 40020000 00002600 |