On Target DRD3_HUMAN 0.40136054/CHEMBL4100634
For the given ligand Aspirin, we have found in our database that, being scored 0.40136054, the most similar ligand is CHEMBL4100634. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL4100634 (Similar Ligand) |
|---|---|
| CO/C3=C/C2CC(c1ccc(OC)cc1)CC(=O)C2/C(O)=C3/OC | CCCCCCC(C)(C)c1ccc2c(c1)OC(C)(C)[C@@H]1CCC(CO)=C[C@@H]21 |
|
|
|
|
|
|
| 00010000 81040008 2200010a 10010200 40483000 00000801 02040140 18001400 00002840 00580840 48100000 40409200 9402800a 00a00000 03000401 0008000c 00000000 02000000 02402098 0a022001 00000100 08000200 05008000 08400012 00001800 80002400 00524000 80000000 00014202 80020002 24020840 00000410 | 04000000 c3000018 2000010a 80010302 00081000 c2800000 02000001 08000602 00040900 00980848 08100000 40008840 00820002 20a00080 11000401 00082008 00800000 22108020 00682010 00022a01 00000100 08000000 01008040 00400410 00201000 c0004400 00404000 80000000 00000302 00024002 24020000 00000400 |