On Target P2Y12_HUMAN 0.2611465/CHEMBL420980
For the given ligand Aspirin, we have found in our database that, being scored 0.2611465, the most similar ligand is CHEMBL420980. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL420980 (Similar Ligand) |
|---|---|
| CO/C3=C/C2CC(c1ccc(OC)cc1)CC(=O)C2/C(O)=C3/OC | COC(=O)CCCCc1ccc2[nH]c3nc(O)nc-3cc2c1 |
|
|
|
|
|
|
| 00010000 81040008 2200010a 10010200 40483000 00000801 02040140 18001400 00002840 00580840 48100000 40409200 9402800a 00a00000 03000401 0008000c 00000000 02000000 02402098 0a022001 00000100 08000200 05008000 08400012 00001800 80002400 00524000 80000000 00014202 80020002 24020840 00000410 | 00014002 03004810 00084102 00010300 000c0040 0000c000 00008000 00000000 00400900 00080840 08108004 40009000 04008808 00e00000 60040140 000c000c 08820000 02000004 00602000 00000001 40020100 08008a28 21800000 80400014 00000000 80000000 00028040 00000000 00400202 00420002 c0040000 0c000480 |