On Target SCN9A_HUMAN 0.41007194/CHEMBL203185
For the given ligand Aspirin, we have found in our database that, being scored 0.41007194, the most similar ligand is CHEMBL203185. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL203185 (Similar Ligand) |
|---|---|
| CO/C3=C/C2CC(c1ccc(OC)cc1)CC(=O)C2/C(O)=C3/OC | O=C(NCc1ccccc1)[C@@H]1CCC[C@H]1C(O)CCc1ccc(OC(F)(F)F)cc1 |
|
|
|
|
|
|
| 00010000 81040008 2200010a 10010200 40483000 00000801 02040140 18001400 00002840 00580840 48100000 40409200 9402800a 00a00000 03000401 0008000c 00000000 02000000 02402098 0a022001 00000100 08000200 05008000 08400012 00001800 80002400 00524000 80000000 00014202 80020002 24020840 00000410 | 00050000 01800008 2010010a 00010600 00181010 00000000 02040000 22001000 00000800 000808c0 08300000 40419000 0400880a 00a00000 01000401 00080008 00000000 02000000 00402000 00020201 80000100 18008610 01000048 00500018 00000000 c0000000 00120000 d0000000 02000302 01060003 20060000 00000e00 |