On Target AA2AR_HUMAN 0.26760563/CHEMBL2042091
For the given ligand Aspirin, we have found in our database that, being scored 0.26760563, the most similar ligand is CHEMBL2042091. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL2042091 (Similar Ligand) |
|---|---|
| CO/C3=C/C2CC(c1ccc(OC)cc1)CC(=O)C2/C(O)=C3/OC | COC(=O)/C(C#N)=C/c1cccc(OC)c1O |
|
|
|
|
|
|
| 00010000 81040008 2200010a 10010200 40483000 00000801 02040140 18001400 00002840 00580840 48100000 40409200 9402800a 00a00000 03000401 0008000c 00000000 02000000 02402098 0a022001 00000100 08000200 05008000 08400012 00001800 80002400 00524000 80000000 00014202 80020002 24020840 00000410 | 00000000 40000008 20000108 00010220 00201000 00080000 82000080 00000400 01808000 00000840 40000000 40129000 0c00c002 00000000 01000003 0008a008 00420400 02000000 10098018 00020200 00000000 08000a00 01000400 00400010 00001000 80000000 00402100 40000400 00480200 00020100 04000000 00000192 |