On Target TRY1_HUMAN 0.3644068/CHEMBL101030
For the given ligand Aspirin, we have found in our database that, being scored 0.3644068, the most similar ligand is CHEMBL101030. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL101030 (Similar Ligand) |
|---|---|
| CO/C3=C/C2CC(c1ccc(OC)cc1)CC(=O)C2/C(O)=C3/OC | O=C1O[C@H]2CCC[C@@H]2[C@@H]1Cc1ccccc1 |
|
|
|
|
|
|
| 00010000 81040008 2200010a 10010200 40483000 00000801 02040140 18001400 00002840 00580840 48100000 40409200 9402800a 00a00000 03000401 0008000c 00000000 02000000 02402098 0a022001 00000100 08000200 05008000 08400012 00001800 80002400 00524000 80000000 00014202 80020002 24020840 00000410 | 00050040 01000008 00000102 00010300 00080000 00000000 00000000 00000000 00000800 00080840 08100000 40009000 04008008 00a00000 00080000 00081008 00820000 02000000 00402008 00000001 00000120 08000a00 01000040 00400010 00000c00 80000000 00000000 00000000 00000202 01020002 00020000 00000400 |