On Target ACE_HUMAN 0.3473054/CHEMBL172801
For the given ligand Aspirin, we have found in our database that, being scored 0.3473054, the most similar ligand is CHEMBL172801. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL172801 (Similar Ligand) |
|---|---|
| CO/C3=C/C2CC(c1ccc(OC)cc1)CC(=O)C2/C(O)=C3/OC | O=C(NC(Cc1ccc(OCc2ccccc2)cc1)C(=O)CCC(=O)N1CCC[C@H]1C(=O)O)c1ccccc1 |
|
|
|
|
|
|
| 00010000 81040008 2200010a 10010200 40483000 00000801 02040140 18001400 00002840 00580840 48100000 40409200 9402800a 00a00000 03000401 0008000c 00000000 02000000 02402098 0a022001 00000100 08000200 05008000 08400012 00001800 80002400 00524000 80000000 00014202 80020002 24020840 00000410 | 04038000 01005808 2010010a 00010600 00081080 00004010 02040000 22001004 00000980 000808c0 08300000 4001b000 0680881a 01210000 81080401 02080008 10000000 02000000 00402008 00020201 00000100 18268e30 03000000 81d0101c 00000800 c0002000 00120000 90000000 04000302 00060003 e0064000 00802600 |