On Target TLR4_HUMAN 0.33128834/CHEMBL4071705
For the given ligand Aspirin, we have found in our database that, being scored 0.33128834, the most similar ligand is CHEMBL4071705. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL4071705 (Similar Ligand) |
|---|---|
| CO/C3=C/C2CC(c1ccc(OC)cc1)CC(=O)C2/C(O)=C3/OC | C[C@@H](OC(=O)c1ccccc1O)[C@]1(O)CC[C@]2(O)[C@]3(O)CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3C[C@@H](OC(=O)/C=C/c3ccccc3)[C@]12C |
|
|
|
|
|
|
| 00010000 81040008 2200010a 10010200 40483000 00000801 02040140 18001400 00002840 00580840 48100000 40409200 9402800a 00a00000 03000401 0008000c 00000000 02000000 02402098 0a022001 00000100 08000200 05008000 08400012 00001800 80002400 00524000 80000000 00014202 80020002 24020840 00000410 | 00040000 81000808 a0000d00 00010300 00280050 00024000 82000080 00000c02 01800100 01100848 40000200 40008000 04028002 02810000 00000406 02083008 00820c00 02000020 3341a018 00022001 00000020 28020a20 05008000 08400014 00201400 80002000 00486000 c0000420 00400200 0102000a e4020000 02000010 |