On Target OPRD_HUMAN 0.44295302/CHEMBL1161423
For the given ligand Aspirin, we have found in our database that, being scored 0.44295302, the most similar ligand is CHEMBL1161423. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL1161423 (Similar Ligand) |
|---|---|
| CO/C3=C/C2CC(c1ccc(OC)cc1)CC(=O)C2/C(O)=C3/OC | Cc1cc(O)cc(C)c1C[C@H](N)[C@@H](O)C/C=C/[C@H](O)[C@@H](Cc1ccccc1)C(=O)O[C@H](CO)Cc1ccccc1 |
|
|
|
|
|
|
| 00010000 81040008 2200010a 10010200 40483000 00000801 02040140 18001400 00002840 00580840 48100000 40409200 9402800a 00a00000 03000401 0008000c 00000000 02000000 02402098 0a022001 00000100 08000200 05008000 08400012 00001800 80002400 00524000 80000000 00014202 80020002 24020840 00000410 | 00000040 c1000008 20000d02 80010700 00000061 00000000 02001000 28000442 10000800 011808c0 08100200 40009000 14028002 00200000 00040424 00089008 08020000 02000000 05402018 02022201 00010120 18000a00 0700c040 89400010 00201c00 80002401 00524000 80000020 04000202 80060002 24000000 00000400 |