On Target CXCR4_HUMAN 0.2857143/CHEMBL4440964
For the given ligand Aspirin, we have found in our database that, being scored 0.2857143, the most similar ligand is CHEMBL4440964. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL4440964 (Similar Ligand) |
|---|---|
| CO/C3=C/C2CC(c1ccc(OC)cc1)CC(=O)C2/C(O)=C3/OC | CCc1cccc(CNCC2CCN(Cc3ccccc3OC)CC2)c1 |
|
|
|
|
|
|
| 00010000 81040008 2200010a 10010200 40483000 00000801 02040140 18001400 00002840 00580840 48100000 40409200 9402800a 00a00000 03000401 0008000c 00000000 02000000 02402098 0a022001 00000100 08000200 05008000 08400012 00001800 80002400 00524000 80000000 00014202 80020002 24020840 00000410 | 00000000 01000008 20100108 00010600 00001001 00000100 12000000 22001400 00200000 001808c0 08200000 50038000 00000802 00000000 01000401 00082008 00000000 02000000 00000400 00020201 00000000 18008000 00000000 00500010 00000000 c0000000 08000000 90000000 00000300 00060002 24040000 00000600 |