On Target CDK5_HUMAN 0.24657534/CHEMBL2000879
For the given ligand Aspirin, we have found in our database that, being scored 0.24657534, the most similar ligand is CHEMBL2000879. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL2000879 (Similar Ligand) |
|---|---|
| CO/C3=C/C2CC(c1ccc(OC)cc1)CC(=O)C2/C(O)=C3/OC | c1ccc(C2CCc3[nH]ncc3C2)cc1 |
|
|
|
|
|
|
| 00010000 81040008 2200010a 10010200 40483000 00000801 02040140 18001400 00002840 00580840 48100000 40409200 9402800a 00a00000 03000401 0008000c 00000000 02000000 02402098 0a022001 00000100 08000200 05008000 08400012 00001800 80002400 00524000 80000000 00014202 80020002 24020840 00000410 | 00000000 43000008 20000182 00810210 01000100 40000002 00002010 00000201 00000800 000c0840 08108000 4000a040 08000000 00200000 00000820 0006200c 00000200 06000000 00402000 00220041 00100100 08100000 04c04800 08400010 00002000 80000001 00120000 00000080 00000006 00024002 00000000 00000520 |