On Target HRH1_HUMAN 0.36567163/CHEMBL59798
For the given ligand Aspirin, we have found in our database that, being scored 0.36567163, the most similar ligand is CHEMBL59798. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL59798 (Similar Ligand) |
|---|---|
| CO/C3=C/C2CC(c1ccc(OC)cc1)CC(=O)C2/C(O)=C3/OC | CCCCCC(=O)c1ccc(OCCCN2CCN(CC(C)C)CC2)cc1 |
|
|
|
|
|
|
| 00010000 81040008 2200010a 10010200 40483000 00000801 02040140 18001400 00002840 00580840 48100000 40409200 9402800a 00a00000 03000401 0008000c 00000000 02000000 02402098 0a022001 00000100 08000200 05008000 08400012 00001800 80002400 00524000 80000000 00014202 80020002 24020840 00000410 | 04010000 01000808 2010010b 04010600 00001000 02000000 02040000 00000000 00000800 00080840 08300000 40009000 0480800a 00202000 01000001 00082008 00200000 02000000 00802000 00020201 00000100 38020200 010000a1 02400014 00000001 80000000 00120000 00000000 08000202 00060002 80020000 00000640 |