On Target NMDZ1_HUMAN 0.2437276/CHEMBL162577
For the given ligand test molecule, we have found in our database that, being scored 0.2437276, the most similar ligand is CHEMBL162577. Check out the elaboration below.
| test molecule (Given Ligand) | CHEMBL162577 (Similar Ligand) |
|---|---|
| COc1ncnc(OC)c1C(=O)Nc3nc(C(F)(F)F)c(c2ccccc2)s3 | COc1ccc(N2C(=O)CN(Cc3c(C(=O)O)[nH]c4cc(Cl)cc(Cl)c34)C2=O)cc1 |
|
|
|
|
|
|
| 10034043 01000019 2018098c 00010610 81000000 10024508 4040c580 18129409 00000900 a0000873 48302a04 50008600 08008008 00210001 21022803 801c200c 00820000 0200408c 04400010 c0a60000 84020001 08082e80 60a00c40 10414828 02041081 cc082980 00220a00 b0000744 0000430c 044e2001 c4005000 8c210380 | 1001c006 09802808 20000128 14010e10 000c1020 0000c020 06004084 0a003009 00000300 00090a48 01280004 4000a800 060088ae 0070a400 810204c1 020c000c 0006c008 02c0200c 08200040 00020001 c0120100 28078fe8 20822002 8240011e 00146000 c0000400 08044000 80000080 08008304 00060001 e004c200 80424220 |