On Target PERM_HUMAN 0.2948718/CHEMBL4294867
For the given ligand test molecule, we have found in our database that, being scored 0.2948718, the most similar ligand is CHEMBL4294867. Check out the elaboration below.
| test molecule (Given Ligand) | CHEMBL4294867 (Similar Ligand) |
|---|---|
| COc1ncnc(OC)c1C(=O)Nc3nc(C(F)(F)F)c(c2ccccc2)s3 | Nc1nc(OCc2ccc(C(F)(F)F)cc2)c2nn[nH]c2n1 |
|
|
|
|
|
|
| 10034043 01000019 2018098c 00010610 81000000 10024508 4040c580 18129409 00000900 a0000873 48302a04 50008600 08008008 00210001 21022803 801c200c 00820000 0200408c 04400010 c0a60000 84020001 08082e80 60a00c40 10414828 02041081 cc082980 00220a00 b0000744 0000430c 044e2001 c4005000 8c210380 | 0400400b 02000818 60100188 00050700 80100040 0000c00c 41002400 00000028 80000300 90000850 00040004 50049800 02001104 01010200 61800200 021c000c 00008000 02800008 00400000 00260000 00020000 0c000060 21800840 00c01004 00002800 80082200 00060308 90000000 00010208 00461000 c0104000 0e680280 |