On Target PDE5A_HUMAN 0.47560975/CHEMBL365694
For the given ligand test molecule, we have found in our database that, being scored 0.47560975, the most similar ligand is CHEMBL365694. Check out the elaboration below.
| test molecule (Given Ligand) | CHEMBL365694 (Similar Ligand) |
|---|---|
| COc1ncnc(OC)c1C(=O)Nc3nc(C(F)(F)F)c(c2ccccc2)s3 | O=C(Cc1csc(NC(=O)c2cnccc2Oc2ccc(Cl)cc2)n1)NO |
|
|
|
|
|
|
| 10034043 01000019 2018098c 00010610 81000000 10024508 4040c580 18129409 00000900 a0000873 48302a04 50008600 08008008 00210001 21022803 801c200c 00820000 0200408c 04400010 c0a60000 84020001 08082e80 60a00c40 10414828 02041081 cc082980 00220a00 b0000744 0000430c 044e2001 c4005000 8c210380 | 10038002 00808818 6008490c 02000610 090c1000 00020500 0210c100 12629408 00000904 200c8a42 0930aa04 50009c00 0a00880e 00000001 01022001 003c201c 00000000 0a004484 00202010 00a64000 c0400000 18c4af80 68800800 4041001c 00047080 0c000580 08300800 b0200504 0440030c 040e2005 85027400 a4630300 |