On Target PAR1_HUMAN 0.31983805/CHEMBL3658404
For the given ligand test molecule, we have found in our database that, being scored 0.31983805, the most similar ligand is CHEMBL3658404. Check out the elaboration below.
| test molecule (Given Ligand) | CHEMBL3658404 (Similar Ligand) |
|---|---|
| COc1ncnc(OC)c1C(=O)Nc3nc(C(F)(F)F)c(c2ccccc2)s3 | CCc1ccc(C2CC(C(=O)Nc3ccccc3)CN(C(=O)c3scnc3C)C2)cc1 |
|
|
|
|
|
|
| 10034043 01000019 2018098c 00010610 81000000 10024508 4040c580 18129409 00000900 a0000873 48302a04 50008600 08008008 00210001 21022803 801c200c 00820000 0200408c 04400010 c0a60000 84020001 08082e80 60a00c40 10414828 02041081 cc082980 00220a00 b0000744 0000430c 044e2001 c4005000 8c210380 | 10034002 01001400 00100902 10010618 20000000 0000a000 00404080 2000d00e 00100980 000809e0 08380a04 50019800 0c008012 00300021 00022440 00040004 01061000 02000085 08200010 84000201 f0121100 182c0ea0 20002000 b1510018 02041000 8c000000 00204000 90000084 0c048004 04060013 a0000000 80412600 |