On Target MK01_HUMAN 0.4084507/CHEMBL1682546
For the given ligand test molecule, we have found in our database that, being scored 0.4084507, the most similar ligand is CHEMBL1682546. Check out the elaboration below.
| test molecule (Given Ligand) | CHEMBL1682546 (Similar Ligand) |
|---|---|
| COc1ncnc(OC)c1C(=O)Nc3nc(C(F)(F)F)c(c2ccccc2)s3 | c1ccc(CNc2nc(-c3ccc4[nH]ncc4c3)cs2)cc1 |
|
|
|
|
|
|
| 10034043 01000019 2018098c 00010610 81000000 10024508 4040c580 18129409 00000900 a0000873 48302a04 50008600 08008008 00210001 21022803 801c200c 00820000 0200408c 04400010 c0a60000 84020001 08082e80 60a00c40 10414828 02041081 cc082980 00220a00 b0000744 0000430c 044e2001 c4005000 8c210380 | 00030002 00000008 a0000900 00010600 01040000 00000000 42000100 120a9088 00000100 20004842 00202a00 50008400 0400080a 00500001 00022001 001c000c 00020000 02006084 04600018 00a20206 00000000 0c00a088 60804800 00610000 00901080 8c100180 00200000 90000464 0000410c 040e2000 00041800 04014220 |