On Target HYES_HUMAN 0.34468085/CHEMBL3099680
For the given ligand test molecule, we have found in our database that, being scored 0.34468085, the most similar ligand is CHEMBL3099680. Check out the elaboration below.
| test molecule (Given Ligand) | CHEMBL3099680 (Similar Ligand) |
|---|---|
| COc1ncnc(OC)c1C(=O)Nc3nc(C(F)(F)F)c(c2ccccc2)s3 | O=C(Nc1ccc(-c2csc(Nc3ccc(O)cc3)n2)cc1)C12CC3CC(CC(C3)C1)C2 |
|
|
|
|
|
|
| 10034043 01000019 2018098c 00010610 81000000 10024508 4040c580 18129409 00000900 a0000873 48302a04 50008600 08008008 00210001 21022803 801c200c 00820000 0200408c 04400010 c0a60000 84020001 08082e80 60a00c40 10414828 02041081 cc082980 00220a00 b0000744 0000430c 044e2001 c4005000 8c210380 | 00034002 01000808 a0100900 00010600 21000000 00002000 42000100 100a8088 00004300 000048c0 00290a04 50019000 0400802a 00108001 00022041 000c000c 00068000 12006080 0e002018 30a20001 40100000 18022690 20006800 00510010 00801080 8c100000 00240000 100104e4 0010c00c 040e2001 60020800 04010202 |