On Target ADRB2_HUMAN 0.49402392/CHEMBL1424697
For the given ligand test molecule, we have found in our database that, being scored 0.49402392, the most similar ligand is CHEMBL1424697. Check out the elaboration below.
| test molecule (Given Ligand) | CHEMBL1424697 (Similar Ligand) |
|---|---|
| COc1ncnc(OC)c1C(=O)Nc3nc(C(F)(F)F)c(c2ccccc2)s3 | Cc1ccc(-c2nc(NC(=O)c3nn(C)cc3[N+](=O)[O-])sc2C)cc1 |
|
|
|
|
|
|
| 10034043 01000019 2018098c 00010610 81000000 10024508 4040c580 18129409 00000900 a0000873 48302a04 50008600 08008008 00210001 21022803 801c200c 00820000 0200408c 04400010 c0a60000 84020001 08082e80 60a00c40 10414828 02041081 cc082980 00220a00 b0000744 0000430c 044e2001 c4005000 8c210380 | 00038006 80001019 a0480980 00010e30 01080000 00110402 40408980 100a9488 16000d00 210048e2 0831aa28 50108400 0c01c08c 00304001 60022801 003c201c 00020000 02806080 05400018 90a20200 00020000 180da680 62804800 12414004 02a45080 8c104980 40260008 90000564 0000c10c 040e2001 84489800 4c212322 |