On Target CHLE_HUMAN 0.3385214/CHEMBL4277303
For the given ligand test molecule, we have found in our database that, being scored 0.3385214, the most similar ligand is CHEMBL4277303. Check out the elaboration below.
| test molecule (Given Ligand) | CHEMBL4277303 (Similar Ligand) |
|---|---|
| COc1ncnc(OC)c1C(=O)Nc3nc(C(F)(F)F)c(c2ccccc2)s3 | CN(C)CCN(CC1CCCN(Cc2csc(Nc3ccccn3)n2)C1)C(=O)c1ccc2ccccc2c1 |
|
|
|
|
|
|
| 10034043 01000019 2018098c 00010610 81000000 10024508 4040c580 18129409 00000900 a0000873 48302a04 50008600 08008008 00210001 21022803 801c200c 00820000 0200408c 04400010 c0a60000 84020001 08082e80 60a00c40 10414828 02041081 cc082980 00220a00 b0000744 0000430c 044e2001 c4005000 8c210380 | 00030002 41003c00 00104904 04010e00 01040002 00106000 00800100 3202b009 00004b00 000909f0 00210a04 50018000 0000880a 00002001 00022400 001c0004 00048000 12004082 08200010 30a09201 40000000 3c0fb6a8 20800801 8271001c 00009080 cc008800 00200080 b0010484 0930810c 040e2811 e0040000 04012203 |