On Target PDE4B_HUMAN 0.38222224/CHEMBL4218878
For the given ligand test molecule, we have found in our database that, being scored 0.38222224, the most similar ligand is CHEMBL4218878. Check out the elaboration below.
| test molecule (Given Ligand) | CHEMBL4218878 (Similar Ligand) |
|---|---|
| COc1ncnc(OC)c1C(=O)Nc3nc(C(F)(F)F)c(c2ccccc2)s3 | O=C(Nc1nccs1)c1ccc(OC(F)F)c(OCC2CC2)c1 |
|
|
|
|
|
|
| 10034043 01000019 2018098c 00010610 81000000 10024508 4040c580 18129409 00000900 a0000873 48302a04 50008600 08008008 00210001 21022803 801c200c 00820000 0200408c 04400010 c0a60000 84020001 08082e80 60a00c40 10414828 02041081 cc082980 00220a00 b0000744 0000430c 044e2001 c4005000 8c210380 | 04030002 44000808 20180109 00210700 00001010 02000400 02048100 12029008 00000100 20000842 00300a00 50408400 0880c802 01000080 11006001 221ca00d 00000000 02004080 00480010 00a20201 00000000 08028680 61000808 00458014 00000100 8c000180 00220000 d0000404 02000308 000e2009 80041000 04010340 |