On Target ACM4_HUMAN 0.32978722/CHEMBL4067974
For the given ligand test molecule, we have found in our database that, being scored 0.32978722, the most similar ligand is CHEMBL4067974. Check out the elaboration below.
| test molecule (Given Ligand) | CHEMBL4067974 (Similar Ligand) |
|---|---|
| COc1ncnc(OC)c1C(=O)Nc3nc(C(F)(F)F)c(c2ccccc2)s3 | COc1ncc(-c2ccc(CNC(=O)c3sc4nnc(C)c(C)c4c3N)cc2)cn1 |
|
|
|
|
|
|
| 10034043 01000019 2018098c 00010610 81000000 10024508 4040c580 18129409 00000900 a0000873 48302a04 50008600 08008008 00210001 21022803 801c200c 00820000 0200408c 04400010 c0a60000 84020001 08082e80 60a00c40 10414828 02041081 cc082980 00220a00 b0000744 0000430c 044e2001 c4005000 8c210380 | 00010042 50808818 22008188 41010618 811c0005 0011550a 02000080 02005008 00000100 020418c0 00200204 60018080 8010881b 08a00022 20023680 801c240c 91233000 0302001e 14600020 58220608 90021000 4c0e8680 208008c4 3060000c 02140003 cc080000 401f0240 80003044 00814304 08470001 c0040104 46c14ae0 |