On Target DRD2_HUMAN 0.36398467/CHEMBL249854
For the given ligand test molecule, we have found in our database that, being scored 0.36398467, the most similar ligand is CHEMBL249854. Check out the elaboration below.
| test molecule (Given Ligand) | CHEMBL249854 (Similar Ligand) |
|---|---|
| COc1ncnc(OC)c1C(=O)Nc3nc(C(F)(F)F)c(c2ccccc2)s3 | CC(=O)c1sc(NC(=O)N[C@@H]2CN(C(C)=O)CC[C@H]2CN2CCC[C@@H](Cc3ccc(F)cc3)C2)nc1C |
|
|
|
|
|
|
| 10034043 01000019 2018098c 00010610 81000000 10024508 4040c580 18129409 00000900 a0000873 48302a04 50008600 08008008 00210001 21022803 801c200c 00820000 0200408c 04400010 c0a60000 84020001 08082e80 60a00c40 10414828 02041081 cc082980 00220a00 b0000744 0000430c 044e2001 c4005000 8c210380 | 00030002 01003600 00180b82 06010e14 01000400 00008410 0040a184 3006a008 00600a00 004a09e4 08300a20 5013a000 0800b00a 00203001 00422900 0034000c 01000410 02004080 00002010 84b04201 80000900 380d2690 20004801 32510018 02051090 8c000b00 00200000 30000405 0802001e 040ea01b 80180000 04252700 |