On Target NEP_HUMAN 0.41463414/CHEMBL34541
For the given ligand test molecule, we have found in our database that, being scored 0.41463414, the most similar ligand is CHEMBL34541. Check out the elaboration below.
| test molecule (Given Ligand) | CHEMBL34541 (Similar Ligand) |
|---|---|
| COc1ncnc(OC)c1C(=O)Nc3nc(C(F)(F)F)c(c2ccccc2)s3 | O=C(O)Cc1csc(NC(=O)[C@H](Cc2ccc(-c3ccccc3)cc2)C[C@@H](COc2ccccc2)C(=O)O)n1 |
|
|
|
|
|
|
| 10034043 01000019 2018098c 00010610 81000000 10024508 4040c580 18129409 00000900 a0000873 48302a04 50008600 08008008 00210001 21022803 801c200c 00820000 0200408c 04400010 c0a60000 84020001 08082e80 60a00c40 10414828 02041081 cc082980 00220a00 b0000744 0000430c 044e2001 c4005000 8c210380 | 04032002 01000208 2018190a 04010700 090810c0 02200400 02108100 30328208 00000900 210e08c2 0830aa00 50019c00 1c80803a 01a00001 11022001 001c200c 00820000 02004080 05402018 10a24001 00000100 18c02e80 71000820 42510010 00005880 8c000400 00200000 10000444 0000421e 040e200b 00007000 24010700 |