On Target ACM1_HUMAN 0.32876712/CHEMBL2206598
For the given ligand test molecule, we have found in our database that, being scored 0.32876712, the most similar ligand is CHEMBL2206598. Check out the elaboration below.
| test molecule (Given Ligand) | CHEMBL2206598 (Similar Ligand) |
|---|---|
| COc1ncnc(OC)c1C(=O)Nc3nc(C(F)(F)F)c(c2ccccc2)s3 | Cc1c[n+]2cc(CNC(=O)[C@H](Cc3ccc(O)cc3)NC(=O)Nc3ccc(C(=O)OC(C)C)cc3)n(C)c2s1 |
|
|
|
|
|
|
| 10034043 01000019 2018098c 00010610 81000000 10024508 4040c580 18129409 00000900 a0000873 48302a04 50008600 08008008 00210001 21022803 801c200c 00820000 0200408c 04400010 c0a60000 84020001 08082e80 60a00c40 10414828 02041081 cc082980 00220a00 b0000744 0000430c 044e2001 c4005000 8c210380 | 10030016 01003a08 20100100 84090e10 00000050 00114000 1240c1a4 2800b00d 00800900 000b18c0 49398a0c d000b800 0400b022 0011a000 000a2440 020c080c 38060018 02400082 88400018 c0830a01 c0000101 b8ab8ea0 21022100 9341011c 02159c00 cc00ac00 083b8400 90000084 0c048204 004e000b e0084004 80014680 |