On Target PGH1_SHEEP 0.53271025/CHEMBL3909479
For the given ligand test molecule, we have found in our database that, being scored 0.53271025, the most similar ligand is CHEMBL3909479. Check out the elaboration below.
| test molecule (Given Ligand) | CHEMBL3909479 (Similar Ligand) |
|---|---|
| COc1ncnc(OC)c1C(=O)Nc3nc(C(F)(F)F)c(c2ccccc2)s3 | COc1ccc(-c2nc(NCC(=O)O)sc2-c2ccc(OC)cc2)cc1 |
|
|
|
|
|
|
| 10034043 01000019 2018098c 00010610 81000000 10024508 4040c580 18129409 00000900 a0000873 48302a04 50008600 08008008 00210001 21022803 801c200c 00820000 0200408c 04400010 c0a60000 84020001 08082e80 60a00c40 10414828 02041081 cc082980 00220a00 b0000744 0000430c 044e2001 c4005000 8c210380 | 00030042 00000009 a0002988 00010610 01001080 00000008 42440180 181a8088 00000000 20004843 00202a80 5000a600 0500903a 00310001 21022803 800c000c 00020000 02006080 24020018 80a20000 00000000 08082a80 62204800 10414000 02841081 8c1c0000 00220200 00000664 0000426c 040e2001 00007800 04210200 |