On Target DRD3_HUMAN 0.31439394/CHEMBL90433
For the given ligand test molecule, we have found in our database that, being scored 0.31439394, the most similar ligand is CHEMBL90433. Check out the elaboration below.
| test molecule (Given Ligand) | CHEMBL90433 (Similar Ligand) |
|---|---|
| COc1ncnc(OC)c1C(=O)Nc3nc(C(F)(F)F)c(c2ccccc2)s3 | CCCN(CCCCNC(=O)c1ccc(-c2ccccc2)cc1)C1CCc2nc(N)sc2C1 |
|
|
|
|
|
|
| 10034043 01000019 2018098c 00010610 81000000 10024508 4040c580 18129409 00000900 a0000873 48302a04 50008600 08008008 00210001 21022803 801c200c 00820000 0200408c 04400010 c0a60000 84020001 08082e80 60a00c40 10414828 02041081 cc082980 00220a00 b0000744 0000430c 044e2001 c4005000 8c210380 | 00032002 01001b00 00100982 43810614 09000120 00000000 034021a0 2a029009 00600980 004d08c0 00208a00 5082a000 8000880a 00201801 02422400 02044004 00020200 06000080 04006018 90204201 20100800 18ae8680 34004800 7041001c 02047000 cc000401 00200000 900001c4 0402410c 04062009 b8040000 20012210 |