On Target 5HT2A_HUMAN 0.35205993/CHEMBL3220217
For the given ligand test molecule, we have found in our database that, being scored 0.35205993, the most similar ligand is CHEMBL3220217. Check out the elaboration below.
| test molecule (Given Ligand) | CHEMBL3220217 (Similar Ligand) |
|---|---|
| COc1ncnc(OC)c1C(=O)Nc3nc(C(F)(F)F)c(c2ccccc2)s3 | O=C1CC(CN2CCC(C(=O)c3ccc(F)cc3)CC2)Cc2nc(N3CCCC3)sc21 |
|
|
|
|
|
|
| 10034043 01000019 2018098c 00010610 81000000 10024508 4040c580 18129409 00000900 a0000873 48302a04 50008600 08008008 00210001 21022803 801c200c 00820000 0200408c 04400010 c0a60000 84020001 08082e80 60a00c40 10414828 02041081 cc082980 00220a00 b0000744 0000430c 044e2001 c4005000 8c210380 | 00030002 01000900 00100982 03810614 09000500 00008012 034021e0 38368009 00500800 204c08c2 0830aa00 5001b400 0400800a 00201801 00622920 02140004 01000200 06004080 00002018 84b04201 a0500900 18ca22c0 64004800 7051401c 02045080 8c000401 00200000 10000585 0002001c 040ea00a 88001000 24e52610 |