On Target AGTR2_HUMAN 0.2818533/CHEMBL166143
For the given ligand test molecule, we have found in our database that, being scored 0.2818533, the most similar ligand is CHEMBL166143. Check out the elaboration below.
| test molecule (Given Ligand) | CHEMBL166143 (Similar Ligand) |
|---|---|
| COc1ncnc(OC)c1C(=O)Nc3nc(C(F)(F)F)c(c2ccccc2)s3 | O=C(O)c1ccccc1-c1ccc(CNc2nc(C(F)(F)F)nc3c2CCCC3)cc1 |
|
|
|
|
|
|
| 10034043 01000019 2018098c 00010610 81000000 10024508 4040c580 18129409 00000900 a0000873 48302a04 50008600 08008008 00210001 21022803 801c200c 00820000 0200408c 04400010 c0a60000 84020001 08082e80 60a00c40 10414828 02041081 cc082980 00220a00 b0000744 0000430c 044e2001 c4005000 8c210380 | 0801a002 01000801 40101102 588d0610 05000120 0000c040 0100b000 02001801 10400900 00080870 2430a004 4000d800 8e008800 00308800 20120000 000c000c 00068a00 06004000 04402008 50200001 04100401 0806aa20 30814040 00440d14 00042000 c0000281 00000000 900010d0 0008410e 00460002 c0041080 200002e0 |