On Target NOS2_HUMAN 0.31060606/CHEMBL490919
For the given ligand test molecule, we have found in our database that, being scored 0.31060606, the most similar ligand is CHEMBL490919. Check out the elaboration below.
| test molecule (Given Ligand) | CHEMBL490919 (Similar Ligand) |
|---|---|
| COc1ncnc(OC)c1C(=O)Nc3nc(C(F)(F)F)c(c2ccccc2)s3 | COc1cccc(N(Cc2cc(=O)[nH]c3c(F)cccc23)C(=O)c2scnc2C)c1 |
|
|
|
|
|
|
| 10034043 01000019 2018098c 00010610 81000000 10024508 4040c580 18129409 00000900 a0000873 48302a04 50008600 08008008 00210001 21022803 801c200c 00820000 0200408c 04400010 c0a60000 84020001 08082e80 60a00c40 10414828 02041081 cc082980 00220a00 b0000744 0000430c 044e2001 c4005000 8c210380 | 10024002 80800808 2010490a 16010618 10041000 00008070 02404080 0200d008 06000000 40000860 04280a04 5000c000 80008802 08701021 01122441 0004000c 01063088 02002184 08200010 84122600 d0121000 08088e88 20812000 f0510008 02045000 cc000002 00304020 80000895 08048304 04068001 80048820 80030220 |