On Target PRGR_HUMAN 0.37387386/CHEMBL1800984
For the given ligand test molecule, we have found in our database that, being scored 0.37387386, the most similar ligand is CHEMBL1800984. Check out the elaboration below.
| test molecule (Given Ligand) | CHEMBL1800984 (Similar Ligand) |
|---|---|
| COc1ncnc(OC)c1C(=O)Nc3nc(C(F)(F)F)c(c2ccccc2)s3 | CC(C)(C(=O)Nc1nccs1)[C@H]1c2ccccc2Oc2cc(O)ccc21 |
|
|
|
|
|
|
| 10034043 01000019 2018098c 00010610 81000000 10024508 4040c580 18129409 00000900 a0000873 48302a04 50008600 08008008 00210001 21022803 801c200c 00820000 0200408c 04400010 c0a60000 84020001 08082e80 60a00c40 10414828 02041081 cc082980 00220a00 b0000744 0000430c 044e2001 c4005000 8c210380 | 00030003 00000208 20180108 00018600 00001000 00000400 46008100 11328208 00000804 200808c2 08300a00 50009440 0c008002 00000000 01002001 0014200c 00000000 02004080 00002018 00a20801 00400100 18000680 60000800 06410410 00000800 ec000000 00120000 50200404 00000398 000ea00b 02021400 04010700 |