On Target DRD4_HUMAN 0.41379312/CHEMBL38349
For the given ligand test molecule, we have found in our database that, being scored 0.41379312, the most similar ligand is CHEMBL38349. Check out the elaboration below.
| test molecule (Given Ligand) | CHEMBL38349 (Similar Ligand) |
|---|---|
| COc1ncnc(OC)c1C(=O)Nc3nc(C(F)(F)F)c(c2ccccc2)s3 | Cc1nc(N2CCN(CCC3NC(=O)c4ccccc43)CC2)sc1C |
|
|
|
|
|
|
| 10034043 01000019 2018098c 00010610 81000000 10024508 4040c580 18129409 00000900 a0000873 48302a04 50008600 08008008 00210001 21022803 801c200c 00820000 0200408c 04400010 c0a60000 84020001 08082e80 60a00c40 10414828 02041081 cc082980 00220a00 b0000744 0000430c 044e2001 c4005000 8c210380 | 0003000a 00801e20 00100980 14010610 01000000 00008000 00400180 32029008 00000800 200809e2 08302a00 50008400 0000880a 00202001 00022c00 02140004 00002000 02004080 00000010 80a00201 80400100 3a0aa6c0 60004821 1241401c 02041080 cc200001 00200000 d0000404 0800013c 048e201b a0041000 04210600 |