On Target PGH2_HUMAN 0.52340424/CHEMBL16996
For the given ligand test molecule, we have found in our database that, being scored 0.52340424, the most similar ligand is CHEMBL16996. Check out the elaboration below.
| test molecule (Given Ligand) | CHEMBL16996 (Similar Ligand) |
|---|---|
| COc1ncnc(OC)c1C(=O)Nc3nc(C(F)(F)F)c(c2ccccc2)s3 | COc1ccc(-c2nc(NCc3ccccc3)sc2-c2ccc(S(N)(=O)=O)cc2)cc1F |
|
|
|
|
|
|
| 10034043 01000019 2018098c 00010610 81000000 10024508 4040c580 18129409 00000900 a0000873 48302a04 50008600 08008008 00210001 21022803 801c200c 00820000 0200408c 04400010 c0a60000 84020001 08082e80 60a00c40 10414828 02041081 cc082980 00220a00 b0000744 0000430c 044e2001 c4005000 8c210380 | 00030052 00801009 a1100988 02b10610 01001008 00000098 42440180 1a1a908c 00000100 20006843 00202a80 70008600 0401883a 00311001 a1222803 801c000c 00020800 02006080 04000018 80a22000 80000000 2808a280 60204800 18414008 02841081 8c180180 00222200 9000066d 0000630c 240ea001 00041800 04210220 |