On Target GLRA3_HUMAN 0.2038835/CHEMBL4070615
For the given ligand test molecule, we have found in our database that, being scored 0.2038835, the most similar ligand is CHEMBL4070615. Check out the elaboration below.
| test molecule (Given Ligand) | CHEMBL4070615 (Similar Ligand) |
|---|---|
| COc1ncnc(OC)c1C(=O)Nc3nc(C(F)(F)F)c(c2ccccc2)s3 | C[C@H]1[C@H]2C(=O)N(C)c3ccncc3[C@H]2CN1S(=O)(=O)c1ccc2c(c1)OCO2 |
|
|
|
|
|
|
| 10034043 01000019 2018098c 00010610 81000000 10024508 4040c580 18129409 00000900 a0000873 48302a04 50008600 08008008 00210001 21022803 801c200c 00820000 0200408c 04400010 c0a60000 84020001 08082e80 60a00c40 10414828 02041081 cc082980 00220a00 b0000744 0000430c 044e2001 c4005000 8c210380 | 00020052 23804608 2110410a 01b00610 200c1700 00042050 0301a000 20040000 00600880 004909e0 40382034 60039000 0c00c803 10300801 81e20201 0024800e 000ce004 02000004 00680c18 00027e03 e0140300 18248600 20804000 99410018 42041800 0108000c 08828010 3000108c 05480600 20060a1b 00000080 20812670 |