On Target TRY1_HUMAN 0.30588236/CHEMBL3642972
For the given ligand test molecule, we have found in our database that, being scored 0.30588236, the most similar ligand is CHEMBL3642972. Check out the elaboration below.
| test molecule (Given Ligand) | CHEMBL3642972 (Similar Ligand) |
|---|---|
| COc1ncnc(OC)c1C(=O)Nc3nc(C(F)(F)F)c(c2ccccc2)s3 | N=C(N)c1ccc(OC(=O)c2ccc(-c3ccc(C(=O)N[C@@H](CC(=O)O)C(=O)O)cc3)s2)cc1 |
|
|
|
|
|
|
| 10034043 01000019 2018098c 00010610 81000000 10024508 4040c580 18129409 00000900 a0000873 48302a04 50008600 08008008 00210001 21022803 801c200c 00820000 0200408c 04400010 c0a60000 84020001 08082e80 60a00c40 10414828 02041081 cc082980 00220a00 b0000744 0000430c 044e2001 c4005000 8c210380 | 0405a048 04005808 20100108 60050600 002012c0 00024080 02040080 0e121028 00001100 00000843 00200200 4000b280 8e808812 00010000 01012401 06080008 19030000 02004009 04c00010 10020211 00012020 58128e80 33100082 10c0101c 02001001 c4002000 40220000 80000244 0000430a 00060001 e0044000 10c10200 |