On Target ACE_HUMAN 0.23333333/CHEMBL1242210
For the given ligand test molecule, we have found in our database that, being scored 0.23333333, the most similar ligand is CHEMBL1242210. Check out the elaboration below.
| test molecule (Given Ligand) | CHEMBL1242210 (Similar Ligand) |
|---|---|
| COc1ncnc(OC)c1C(=O)Nc3nc(C(F)(F)F)c(c2ccccc2)s3 | CN1CCN(c2cccc3nc(CN(C)[C@H]4CCCc5cccnc54)c(CO)n23)CC1 |
|
|
|
|
|
|
| 10034043 01000019 2018098c 00010610 81000000 10024508 4040c580 18129409 00000900 a0000873 48302a04 50008600 08008008 00210001 21022803 801c200c 00820000 0200408c 04400010 c0a60000 84020001 08082e80 60a00c40 10414828 02041081 cc082980 00220a00 b0000744 0000430c 044e2001 c4005000 8c210380 | 1001400a 01005800 001041a2 1c800e10 01041160 00104000 0100e000 2a003803 00500b00 200c02c0 4931a004 40815800 04000882 00b02800 00060c40 021c010c 0806aa00 07804006 88202408 40a00201 40120100 7e01a820 21804822 02700116 00140000 c1000401 0800c0c0 90000080 0840811e 00c63802 e0041100 a0004680 |