On Target 5HT1B_HUMAN 0.3/CHEMBL321562
For the given ligand test molecule, we have found in our database that, being scored 0.3, the most similar ligand is CHEMBL321562. Check out the elaboration below.
| test molecule (Given Ligand) | CHEMBL321562 (Similar Ligand) |
|---|---|
| COc1ncnc(OC)c1C(=O)Nc3nc(C(F)(F)F)c(c2ccccc2)s3 | COc1ccccc1C(=O)Nc1ccc2[nH]cc(C3CCN(C)CC3)c2n1 |
|
|
|
|
|
|
| 10034043 01000019 2018098c 00010610 81000000 10024508 4040c580 18129409 00000900 a0000873 48302a04 50008600 08008008 00210001 21022803 801c200c 00820000 0200408c 04400010 c0a60000 84020001 08082e80 60a00c40 10414828 02041081 cc082980 00220a00 b0000744 0000430c 044e2001 c4005000 8c210380 | 00004002 01800a08 20184188 40810610 000c1240 00020100 0200a000 22001400 00400900 200808c0 08380004 5001e000 08008802 00500800 01040841 000c200c 08040000 02004008 08600400 00a20205 40100100 5c028608 21812840 80700014 00042000 80000080 08008880 90000184 00008308 0006180b 84041200 00000720 |