On Target TLR4_HUMAN 0.27307692/CHEMBL4213787
For the given ligand test molecule, we have found in our database that, being scored 0.27307692, the most similar ligand is CHEMBL4213787. Check out the elaboration below.
| test molecule (Given Ligand) | CHEMBL4213787 (Similar Ligand) |
|---|---|
| COc1ncnc(OC)c1C(=O)Nc3nc(C(F)(F)F)c(c2ccccc2)s3 | O=C(NNC(=O)c1csc(-c2ccc(Cl)cc2Cl)n1)c1ccccn1 |
|
|
|
|
|
|
| 10034043 01000019 2018098c 00010610 81000000 10024508 4040c580 18129409 00000900 a0000873 48302a04 50008600 08008008 00210001 21022803 801c200c 00820000 0200408c 04400010 c0a60000 84020001 08082e80 60a00c40 10414828 02041081 cc082980 00220a00 b0000744 0000430c 044e2001 c4005000 8c210380 | 00028006 08402800 00004900 10011600 00040022 00000022 00400190 0819d049 01000000 d1000849 00190a05 50008a00 02008814 00300401 20022008 020c0024 10000000 02002080 05200010 00408001 40000000 0842a780 61802000 80410014 0210b000 8c010a12 00240050 00001a04 0000000c 056e1003 80140804 02074080 |