On Target CNR2_HUMAN 0.44017094/CHEMBL1762299
For the given ligand test molecule, we have found in our database that, being scored 0.44017094, the most similar ligand is CHEMBL1762299. Check out the elaboration below.
| test molecule (Given Ligand) | CHEMBL1762299 (Similar Ligand) |
|---|---|
| COc1ncnc(OC)c1C(=O)Nc3nc(C(F)(F)F)c(c2ccccc2)s3 | O=C(Nc1ncc(-c2ccccc2)s1)N1CCCN(C(=O)C2CCOCC2)CC1 |
|
|
|
|
|
|
| 10034043 01000019 2018098c 00010610 81000000 10024508 4040c580 18129409 00000900 a0000873 48302a04 50008600 08008008 00210001 21022803 801c200c 00820000 0200408c 04400010 c0a60000 84020001 08082e80 60a00c40 10414828 02041081 cc082980 00220a00 b0000744 0000430c 044e2001 c4005000 8c210380 | 00070042 01003400 00180380 04010f10 80180000 00000408 40008184 3812a008 00000200 000209e5 00300a20 50109200 0c00b002 00012001 00002803 803c100c 00020410 02004180 04400010 80a00201 08000120 38090680 21200801 12410018 02050401 8c080b00 00000200 30000644 08004218 000e2011 00100000 04212b00 |