On Target MTOR_HUMAN 0.39694658/CHEMBL1773603
For the given ligand test molecule, we have found in our database that, being scored 0.39694658, the most similar ligand is CHEMBL1773603. Check out the elaboration below.
| test molecule (Given Ligand) | CHEMBL1773603 (Similar Ligand) |
|---|---|
| COc1ncnc(OC)c1C(=O)Nc3nc(C(F)(F)F)c(c2ccccc2)s3 | COc1ccc(S(=O)(=O)Nc2cc(-c3ccc4nc(NC(C)=O)sc4c3)cnc2C)cc1 |
|
|
|
|
|
|
| 10034043 01000019 2018098c 00010610 81000000 10024508 4040c580 18129409 00000900 a0000873 48302a04 50008600 08008008 00210001 21022803 801c200c 00820000 0200408c 04400010 c0a60000 84020001 08082e80 60a00c40 10414828 02041081 cc082980 00220a00 b0000744 0000430c 044e2001 c4005000 8c210380 | 00032012 1080400c 2108490e 10b10630 000c1020 04008408 02008100 10429018 00400100 200018d2 00302a04 70008400 08048c2a 80c00021 812a30c1 8206040c 000a2000 0200448c 04600810 10a26002 c0000000 4c048e80 70840840 0a610008 00040081 8c080000 48800240 000004cc 0040460e 204e2801 00001020 044107e0 |