On Target TRXR1_HUMAN 0.21864952/CHEMBL4281382
For the given ligand test molecule, we have found in our database that, being scored 0.21864952, the most similar ligand is CHEMBL4281382. Check out the elaboration below.
| test molecule (Given Ligand) | CHEMBL4281382 (Similar Ligand) |
|---|---|
| COc1ncnc(OC)c1C(=O)Nc3nc(C(F)(F)F)c(c2ccccc2)s3 | COc1cc(OC)c2c(=O)c(OCCCOc3ccccc3/C=C/C(=O)/C=C/c3ccccn3)c(-c3cc(OC)c(OC)c(OC)c3)oc2c1 |
|
|
|
|
|
|
| 10034043 01000019 2018098c 00010610 81000000 10024508 4040c580 18129409 00000900 a0000873 48302a04 50008600 08008008 00210001 21022803 801c200c 00820000 0200408c 04400010 c0a60000 84020001 08082e80 60a00c40 10414828 02041081 cc082980 00220a00 b0000744 0000430c 044e2001 c4005000 8c210380 | 0c402043 40200018 28084308 10110600 0025122d 82004020 c2040080 48802608 038a4104 41100840 00000094 41008000 4080cc12 00240088 01020023 020ca20c 00064440 2a008844 1f298204 00821a02 40240001 18008e28 31a08000 02594810 09400000 82000000 144a20f4 48108248 00406304 91860a09 45401240 02240002 |