On Target CAH2_HUMAN 0.38132295/CHEMBL4089153
For the given ligand test molecule, we have found in our database that, being scored 0.38132295, the most similar ligand is CHEMBL4089153. Check out the elaboration below.
| test molecule (Given Ligand) | CHEMBL4089153 (Similar Ligand) |
|---|---|
| COc1ncnc(OC)c1C(=O)Nc3nc(C(F)(F)F)c(c2ccccc2)s3 | COc1c(F)cccc1-c1ccc(CC(=O)N(C)c2nc(C)c(S(N)(=O)=O)s2)cc1 |
|
|
|
|
|
|
| 10034043 01000019 2018098c 00010610 81000000 10024508 4040c580 18129409 00000900 a0000873 48302a04 50008600 08008008 00210001 21022803 801c200c 00820000 0200408c 04400010 c0a60000 84020001 08082e80 60a00c40 10414828 02041081 cc082980 00220a00 b0000744 0000430c 044e2001 c4005000 8c210380 | 00432002 00040018 20180908 03390600 01001000 00800411 02028100 1032b008 02000100 a088b842 08302a00 50009c00 4900840e 00441001 c1122001 000c200c 20022880 02204180 04000210 10a22000 00001100 b8202680 70000800 81414010 00003080 ac000000 14200004 0001044d 1400431c 340ea00b 00003280 04010720 |