On Target CDK5_HUMAN 0.49253732/CHEMBL1983980
For the given ligand test molecule, we have found in our database that, being scored 0.49253732, the most similar ligand is CHEMBL1983980. Check out the elaboration below.
| test molecule (Given Ligand) | CHEMBL1983980 (Similar Ligand) |
|---|---|
| COc1ncnc(OC)c1C(=O)Nc3nc(C(F)(F)F)c(c2ccccc2)s3 | O=C(Nc1nc2ccccc2s1)c1cccc2c1CN(c1nc(C(=O)O)c(-c3ccc(CO)cc3)s1)CC2 |
|
|
|
|
|
|
| 10034043 01000019 2018098c 00010610 81000000 10024508 4040c580 18129409 00000900 a0000873 48302a04 50008600 08008008 00210001 21022803 801c200c 00820000 0200408c 04400010 c0a60000 84020001 08082e80 60a00c40 10414828 02041081 cc082980 00220a00 b0000744 0000430c 044e2001 c4005000 8c210380 | 0803805a 10000811 00180988 10050610 010c1021 0000c408 50408180 1a329018 00400380 20081a43 08382a05 50108e00 0a0088aa 00610001 20022ccb 889c050c 10028200 020040a0 04200410 90a10200 40020000 5c2aaea0 61a04800 93614014 02051091 cc081190 48204220 90000644 0400411c 060e2883 e0041100 04610700 |