On Target PTGES_HUMAN 0.4160584/CHEMBL3094428
For the given ligand test molecule, we have found in our database that, being scored 0.4160584, the most similar ligand is CHEMBL3094428. Check out the elaboration below.
| test molecule (Given Ligand) | CHEMBL3094428 (Similar Ligand) |
|---|---|
| COc1ncnc(OC)c1C(=O)Nc3nc(C(F)(F)F)c(c2ccccc2)s3 | CCCCCCC(Sc1nc(Cl)cc(Nc2nc(-c3ccccc3)c(-c3ccccc3)s2)n1)C(=O)O |
|
|
|
|
|
|
| 10034043 01000019 2018098c 00010610 81000000 10024508 4040c580 18129409 00000900 a0000873 48302a04 50008600 08008008 00210001 21022803 801c200c 00820000 0200408c 04400010 c0a60000 84020001 08082e80 60a00c40 10414828 02041081 cc082980 00220a00 b0000744 0000430c 044e2001 c4005000 8c210380 | 00038042 43000101 800009a0 08192610 01190000 00006008 404081a0 181a8988 04264300 0000c8d3 00201a84 50029b00 0621800c 00b50001 20022803 801c000c 04070000 16016080 04402038 b0a05001 00000000 082cbb80 21b04940 10f90010 02841081 9c1c0000 00288200 300106e4 0230400c 044e2001 60022800 056300c2 |